![4-[(6-Chloropyridin-3-yl)carbonyl]morpholine (CAS: 64614-49-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678978.png "4-[(6-Chloropyridin-3-yl)carbonyl]morpholine chemical structure")
4-[(6-Chloropyridin-3-yl)carbonyl]morpholine
Catalog No: FT-0678978
CAS No: 64614-49-9
- Chemical Name: 4-[(6-Chloropyridin-3-yl)carbonyl]morpholine
- Molecular Formula: C10H11ClN2O2
- Molecular Weight: 226.66
- InChI Key: FCXXBTYIFBFZML-UHFFFAOYSA-N
- InChI: InChI=1S/C10H11ClN2O2/c11-9-2-1-8(7-12-9)10(14)13-3-5-15-6-4-13/h1-2,7H,3-6H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 226.660 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 64614-49-9 |
| Bolling_Point: | 410.6±45.0 °C at 760 mmHg |
| Product_Name: | (6-Chloro-3-pyridinyl)(4-morpholinyl)methanone |
| Melting_Point: | N/A |
| Flash_Point: | 202.1±28.7 °C |
| MF: | C10H11ClN2O2 |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | -0.44 |
| Flash_Point: | 202.1±28.7 °C |
| Refractive_Index: | 1.573 |
| FW: | 226.660 |
| PSA: | 42.43000 |
| MF: | C10H11ClN2O2 |
| Bolling_Point: | 410.6±45.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.0 mmHg at 25°C |
| Exact_Mass: | 226.050903 |
| Warning_Statement: | P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2934999090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)